C13H12BCl2NO6 — CID 168538894
[2,4-dichloro-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]boronic acid (PubChem CID 168538894) has the molecular formula C13H12BCl2NO6 and a molecular weight of 359.96 g/mol. Its IUPAC name is [2,4-dichloro-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]boronic acid.
| Compound Name | [2,4-dichloro-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]boronic acid |
|---|---|
| PubChem CID | 168538894 |
| Molecular Formula | C13H12BCl2NO6 |
| Molecular Weight | 359.96 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | [2,4-dichloro-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]boronic acid |
| SMILES | CC1(C)OC(=O)C(=CNc2cc(B(O)O)c(Cl)cc2Cl)C(=O)O1 |
| InChI | InChI=1S/C13H12BCl2NO6/c1-13(2)22-11(18)6(12(19)23-13)5-17-10-3-7(14(20)21)8(15)4-9(10)16/h3-5,17,20-21H,1-2H3 |
| InChIKey | ODLJZOIFRLWDOV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.96 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|