C14H13Cl2NO4 — CID 168540834
5-[(2,4-dichloro-5-methylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168540834) has the molecular formula C14H13Cl2NO4 and a molecular weight of 330.17 g/mol. Its IUPAC name is 5-[(2,4-dichloro-5-methylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2,4-dichloro-5-methylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168540834 |
| Molecular Formula | C14H13Cl2NO4 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 5-[(2,4-dichloro-5-methylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | Cc1cc(NC=C2C(=O)OC(C)(C)OC2=O)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl2NO4/c1-7-4-11(10(16)5-9(7)15)17-6-8-12(18)20-14(2,3)21-13(8)19/h4-6,17H,1-3H3 |
| InChIKey | MYIKYZBDAOUHJL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|