C18H21NO9 — CID 168539630
methyl 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,4,5-trimethoxybenzoate (PubChem CID 168539630) has the molecular formula C18H21NO9 and a molecular weight of 395.36 g/mol. Its IUPAC name is methyl 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,4,5-trimethoxybenzoate.
| Compound Name | methyl 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 168539630 |
| Molecular Formula | C18H21NO9 |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | methyl 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,4,5-trimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)c(OC)c1NC=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C18H21NO9/c1-18(2)27-16(21)10(17(22)28-18)8-19-12-9(15(20)26-6)7-11(23-3)13(24-4)14(12)25-5/h7-8,19H,1-6H3 |
| InChIKey | CJQPJOILKDXQBY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|