C25H22N2O7 — CID 168538631
4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide (PubChem CID 168538631) has the molecular formula C25H22N2O7 and a molecular weight of 462.46 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide.
| Compound Name | 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 168538631 |
| Molecular Formula | C25H22N2O7 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1cc2ccccc2c(NC=C2C(=O)OC(C)(C)OC2=O)c1O |
| InChI | InChI=1S/C25H22N2O7/c1-25(2)33-23(30)17(24(31)34-25)13-26-20-15-9-5-4-8-14(15)12-16(21(20)28)22(29)27-18-10-6-7-11-19(18)32-3/h4-13,26,28H,1-3H3,(H,27,29) |
| InChIKey | MXVWMIZOKMWWRO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|