C26H18N2O5 — CID 168517737
4-(1,3-dioxoisoindol-2-yl)-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide (PubChem CID 168517737) has the molecular formula C26H18N2O5 and a molecular weight of 438.44 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 168517737 |
| Molecular Formula | C26H18N2O5 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1cc2ccccc2c(N2C(=O)c3ccccc3C2=O)c1O |
| InChI | InChI=1S/C26H18N2O5/c1-33-21-13-7-6-12-20(21)27-24(30)19-14-15-8-2-3-9-16(15)22(23(19)29)28-25(31)17-10-4-5-11-18(17)26(28)32/h2-14,29H,1H3,(H,27,30) |
| InChIKey | DTSLBXHPJWFQLR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|