C27H23N3O4 — CID 1354025
4-[(4-acetamidophenyl)iminomethyl]-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide (PubChem CID 1354025) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is 4-[(4-acetamidophenyl)iminomethyl]-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide.
| Compound Name | 4-[(4-acetamidophenyl)iminomethyl]-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 1354025 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 4-[(4-acetamidophenyl)iminomethyl]-3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1cc2ccccc2c(/C=N/c2ccc(NC(C)=O)cc2)c1O |
| InChI | InChI=1S/C27H23N3O4/c1-17(31)29-20-13-11-19(12-14-20)28-16-23-21-8-4-3-7-18(21)15-22(26(23)32)27(33)30-24-9-5-6-10-25(24)34-2/h3-16,32H,1-2H3,(H,29,31)(H,30,33)/b28-16+ |
| InChIKey | ZWQULGQEMXZDOK-LQKURTRISA-N |
| XLogP | 5.52 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|