C25H19ClN2O2 — CID 4172097
4-[(2-chlorophenyl)iminomethyl]-3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide (PubChem CID 4172097) has the molecular formula C25H19ClN2O2 and a molecular weight of 414.89 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)iminomethyl]-3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide.
| Compound Name | 4-[(2-chlorophenyl)iminomethyl]-3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 4172097 |
| Molecular Formula | C25H19ClN2O2 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 4-[(2-chlorophenyl)iminomethyl]-3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide |
| SMILES | Cc1ccccc1NC(=O)c1cc2ccccc2c(/C=N/c2ccccc2Cl)c1O |
| InChI | InChI=1S/C25H19ClN2O2/c1-16-8-2-6-12-22(16)28-25(30)19-14-17-9-3-4-10-18(17)20(24(19)29)15-27-23-13-7-5-11-21(23)26/h2-15,29H,1H3,(H,28,30)/b27-15+ |
| InChIKey | QUNIAGQZWWNOOV-JFLMPSFJSA-N |
| XLogP | 6.51 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|