C17H12ClN3O2 — CID 135970928
N-(2-chlorophenyl)-4-diazenyl-3-hydroxynaphthalene-2-carboxamide (PubChem CID 135970928) has the molecular formula C17H12ClN3O2 and a molecular weight of 325.76 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-diazenyl-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-(2-chlorophenyl)-4-diazenyl-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 135970928 |
| Molecular Formula | C17H12ClN3O2 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-(2-chlorophenyl)-4-diazenyl-3-hydroxynaphthalene-2-carboxamide |
| SMILES | [H]/N=N/c1c(O)c(C(=O)Nc2ccccc2Cl)cc2ccccc12 |
| InChI | InChI=1S/C17H12ClN3O2/c18-13-7-3-4-8-14(13)20-17(23)12-9-10-5-1-2-6-11(10)15(21-19)16(12)22/h1-9,19,22H,(H,20,23)/b21-19+ |
| InChIKey | FAFNNJLOXAQBFY-XUTLUUPISA-N |
| XLogP | 5.11 |
| TPSA | 85.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|