C40H22Cl6N6O4 — CID 135985589
2,5-dichloro-1-N,4-N-bis[4-[(2,5-dichlorophenyl)diazenyl]-3-hydroxynaphthalen-2-yl]benzene-1,4-dicarboxamide (PubChem CID 135985589) has the molecular formula C40H22Cl6N6O4 and a molecular weight of 863.37 g/mol. Its IUPAC name is 2,5-dichloro-1-N,4-N-bis[4-[(2,5-dichlorophenyl)diazenyl]-3-hydroxynaphthalen-2-yl]benzene-1,4-dicarboxamide.
| Compound Name | 2,5-dichloro-1-N,4-N-bis[4-[(2,5-dichlorophenyl)diazenyl]-3-hydroxynaphthalen-2-yl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 135985589 |
| Molecular Formula | C40H22Cl6N6O4 |
| Molecular Weight | 863.37 g/mol |
| Exact Mass | 859.98 |
| IUPAC Name | 2,5-dichloro-1-N,4-N-bis[4-[(2,5-dichlorophenyl)diazenyl]-3-hydroxynaphthalen-2-yl]benzene-1,4-dicarboxamide |
| SMILES | O=C(Nc1cc2ccccc2c(/N=N/c2cc(Cl)ccc2Cl)c1O)c1cc(Cl)c(C(=O)Nc2cc3ccccc3c(/N=N/c3cc(Cl)ccc3Cl)c2O)cc1Cl |
| InChI | InChI=1S/C40H22Cl6N6O4/c41-21-9-11-27(43)31(15-21)49-51-35-23-7-3-1-5-19(23)13-33(37(35)53)47-39(55)25-17-30(46)26(18-29(25)45)40(56)48-34-14-20-6-2-4-8-24(20)36(38(34)54)52-50-32-16-22(42)10-12-28(32)44/h1-18,53-54H,(H,47,55)(H,48,56)/b51-49+,52-50+ |
| InChIKey | BSBKKQZVRQKOGY-BILXIUEVSA-N |
| XLogP | 14.66 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.37 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|