C23H15ClN3O3- — CID 136688245
1-[(5-chloro-2-hydroxyphenyl)diazenyl]-3-(phenylcarbamoyl)naphthalen-2-olate (PubChem CID 136688245) has the molecular formula C23H15ClN3O3- and a molecular weight of 416.84 g/mol. Its IUPAC name is 1-[(5-chloro-2-hydroxyphenyl)diazenyl]-3-(phenylcarbamoyl)naphthalen-2-olate.
| Compound Name | 1-[(5-chloro-2-hydroxyphenyl)diazenyl]-3-(phenylcarbamoyl)naphthalen-2-olate |
|---|---|
| PubChem CID | 136688245 |
| Molecular Formula | C23H15ClN3O3- |
| Molecular Weight | 416.84 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 1-[(5-chloro-2-hydroxyphenyl)diazenyl]-3-(phenylcarbamoyl)naphthalen-2-olate |
| SMILES | O=C(Nc1ccccc1)c1cc2ccccc2c(/N=N/c2cc(Cl)ccc2O)c1[O-] |
| InChI | InChI=1S/C23H16ClN3O3/c24-15-10-11-20(28)19(13-15)26-27-21-17-9-5-4-6-14(17)12-18(22(21)29)23(30)25-16-7-2-1-3-8-16/h1-13,28-29H,(H,25,30)/p-1/b27-26+ |
| InChIKey | DUGZYCYBXWLQDR-CYYJNZCTSA-M |
| XLogP | 5.94 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.84 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|