C27H25N3O3 — CID 135991568
4-[(4-butyl-2-hydroxyphenyl)diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide (PubChem CID 135991568) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is 4-[(4-butyl-2-hydroxyphenyl)diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide.
| Compound Name | 4-[(4-butyl-2-hydroxyphenyl)diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 135991568 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 4-[(4-butyl-2-hydroxyphenyl)diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide |
| SMILES | CCCCc1ccc(/N=N/c2c(O)c(C(=O)Nc3ccccc3)cc3ccccc23)c(O)c1 |
| InChI | InChI=1S/C27H25N3O3/c1-2-3-9-18-14-15-23(24(31)16-18)29-30-25-21-13-8-7-10-19(21)17-22(26(25)32)27(33)28-20-11-5-4-6-12-20/h4-8,10-17,31-32H,2-3,9H2,1H3,(H,28,33)/b30-29+ |
| InChIKey | KQZRXCUMILNUPJ-QVIHXGFCSA-N |
| XLogP | 7.26 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|