C44H46N7O4+ — CID 135738328
2-[[3-hydroxy-4-[[4-[2-[4-[[2-hydroxy-3-(propylcarbamoyl)naphthalen-1-yl]diazenyl]phenyl]ethyl]phenyl]diazenyl]naphthalene-2-carbonyl]amino]ethyl-trimethylazanium (PubChem CID 135738328) has the molecular formula C44H46N7O4+ and a molecular weight of 736.90 g/mol. Its IUPAC name is 2-[[3-hydroxy-4-[[4-[2-[4-[[2-hydroxy-3-(propylcarbamoyl)naphthalen-1-yl]diazenyl]phenyl]ethyl]phenyl]diazenyl]naphthalene-2-carbonyl]amino]ethyl-trimethylazanium.
| Compound Name | 2-[[3-hydroxy-4-[[4-[2-[4-[[2-hydroxy-3-(propylcarbamoyl)naphthalen-1-yl]diazenyl]phenyl]ethyl]phenyl]diazenyl]naphthalene-2-carbonyl]amino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 135738328 |
| Molecular Formula | C44H46N7O4+ |
| Molecular Weight | 736.90 g/mol |
| Exact Mass | 736.36 |
| IUPAC Name | 2-[[3-hydroxy-4-[[4-[2-[4-[[2-hydroxy-3-(propylcarbamoyl)naphthalen-1-yl]diazenyl]phenyl]ethyl]phenyl]diazenyl]naphthalene-2-carbonyl]amino]ethyl-trimethylazanium |
| SMILES | CCCNC(=O)c1cc2ccccc2c(/N=N/c2ccc(CCc3ccc(/N=N/c4c(O)c(C(=O)NCC[N+](C)(C)C)cc5ccccc45)cc3)cc2)c1O |
| InChI | InChI=1S/C44H45N7O4/c1-5-24-45-43(54)37-27-31-10-6-8-12-35(31)39(41(37)52)49-47-33-20-16-29(17-21-33)14-15-30-18-22-34(23-19-30)48-50-40-36-13-9-7-11-32(36)28-38(42(40)53)44(55)46-25-26-51(2,3)4/h6-13,16-23,27-28H,5,14-15,24-26H2,1-4H3,(H3-,45,46,47,48,52,53,54,55)/p+1 |
| InChIKey | HPYARDBVCPAFHT-UHFFFAOYSA-O |
| XLogP | 9.60 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.90 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|