C23H29N2O+ — CID 118566323
2-(anthracene-9-carbonylamino)ethyl-triethylazanium (PubChem CID 118566323) has the molecular formula C23H29N2O+ and a molecular weight of 349.50 g/mol. Its IUPAC name is 2-(anthracene-9-carbonylamino)ethyl-triethylazanium.
| Compound Name | 2-(anthracene-9-carbonylamino)ethyl-triethylazanium |
|---|---|
| PubChem CID | 118566323 |
| Molecular Formula | C23H29N2O+ |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 2-(anthracene-9-carbonylamino)ethyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)CCNC(=O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C23H28N2O/c1-4-25(5-2,6-3)16-15-24-23(26)22-20-13-9-7-11-18(20)17-19-12-8-10-14-21(19)22/h7-14,17H,4-6,15-16H2,1-3H3/p+1 |
| InChIKey | PUTZOPHLJHQMQO-UHFFFAOYSA-O |
| XLogP | 4.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|