C20H17F2NO2 — CID 10382680
N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide (PubChem CID 10382680) has the molecular formula C20H17F2NO2 and a molecular weight of 341.36 g/mol. Its IUPAC name is N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide.
| Compound Name | N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide |
|---|---|
| PubChem CID | 10382680 |
| Molecular Formula | C20H17F2NO2 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide |
| SMILES | O=C(NCC1C(CO)C1(F)F)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C20H17F2NO2/c21-20(22)16(17(20)11-24)10-23-19(25)18-14-7-3-1-5-12(14)9-13-6-2-4-8-15(13)18/h1-9,16-17,24H,10-11H2,(H,23,25) |
| InChIKey | BXEOPTFUOQJGQA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|