About N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide
N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide (PubChem CID 10382680) has the molecular formula C20H17F2NO2
and a molecular weight of 341.36 g/mol. Its IUPAC name is N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide.
Molecular Properties
| Compound Name | N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide |
| PubChem CID | 10382680 |
| Molecular Formula | C20H17F2NO2 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide |
| SMILES | O=C(NCC1C(CO)C1(F)F)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C20H17F2NO2/c21-20(22)16(17(20)11-24)10-23-19(25)18-14-7-3-1-5-12(14)9-13-6-2-4-8-15(13)18/h1-9,16-17,24H,10-11H2,(H,23,25) |
| InChIKey | BXEOPTFUOQJGQA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide?
The IUPAC name of N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide (CID 10382680) is N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide.
What is the SMILES notation for N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide?
The canonical SMILES for N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide is O=C(NCC1C(CO)C1(F)F)c1c2ccccc2cc2ccccc12.
What is the InChIKey of N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide?
The InChIKey is BXEOPTFUOQJGQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F2NO2/c21-20(22)16(17(20)11-24)10-23-19(25)18-14-7-3-1-5-12(14)9-13-6-2-4-8-15(13)18/h1-9,16-17,24H,10-11H2,(H,23,25).
What are the key properties of N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide?
N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide has a molecular weight of 341.36 g/mol, XLogP of 3.60, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methyl]anthracene-9-carboxamide is sourced from PubChem (CID 10382680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).