C47H64N4O6 — CID 161449264
1-[(3,5-dicarboxyphenyl)diazenyl]-3-(phenylcarbamoyl)naphthalen-2-olate;didecyl(dimethyl)azanium (PubChem CID 161449264) has the molecular formula C47H64N4O6 and a molecular weight of 781.05 g/mol. Its IUPAC name is 1-[(3,5-dicarboxyphenyl)diazenyl]-3-(phenylcarbamoyl)naphthalen-2-olate;didecyl(dimethyl)azanium.
| Compound Name | 1-[(3,5-dicarboxyphenyl)diazenyl]-3-(phenylcarbamoyl)naphthalen-2-olate;didecyl(dimethyl)azanium |
|---|---|
| PubChem CID | 161449264 |
| Molecular Formula | C47H64N4O6 |
| Molecular Weight | 781.05 g/mol |
| Exact Mass | 780.48 |
| IUPAC Name | 1-[(3,5-dicarboxyphenyl)diazenyl]-3-(phenylcarbamoyl)naphthalen-2-olate;didecyl(dimethyl)azanium |
| SMILES | CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.O=C(O)c1cc(/N=N/c2c([O-])c(C(=O)Nc3ccccc3)cc3ccccc23)cc(C(=O)O)c1 |
| InChI | InChI=1S/C25H17N3O6.C22H48N/c29-22-20(23(30)26-17-7-2-1-3-8-17)13-14-6-4-5-9-19(14)21(22)28-27-18-11-15(24(31)32)10-16(12-18)25(33)34;1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2/h1-13,29H,(H,26,30)(H,31,32)(H,33,34);5-22H2,1-4H3/q;+1/p-1/b28-27+; |
| InChIKey | WAHQIXQZWUEGJT-RXQWRGDBSA-M |
| XLogP | 12.32 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.05 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|