C23H23N2O3- — CID 22081940
6-(pentylcarbamoyl)-3-(phenylcarbamoyl)naphthalen-2-olate (PubChem CID 22081940) has the molecular formula C23H23N2O3- and a molecular weight of 375.45 g/mol. Its IUPAC name is 6-(pentylcarbamoyl)-3-(phenylcarbamoyl)naphthalen-2-olate.
| Compound Name | 6-(pentylcarbamoyl)-3-(phenylcarbamoyl)naphthalen-2-olate |
|---|---|
| PubChem CID | 22081940 |
| Molecular Formula | C23H23N2O3- |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 6-(pentylcarbamoyl)-3-(phenylcarbamoyl)naphthalen-2-olate |
| SMILES | CCCCCNC(=O)c1ccc2cc([O-])c(C(=O)Nc3ccccc3)cc2c1 |
| InChI | InChI=1S/C23H24N2O3/c1-2-3-7-12-24-22(27)17-11-10-16-15-21(26)20(14-18(16)13-17)23(28)25-19-8-5-4-6-9-19/h4-6,8-11,13-15,26H,2-3,7,12H2,1H3,(H,24,27)(H,25,28)/p-1 |
| InChIKey | PHMWUSDRHRDJID-UHFFFAOYSA-M |
| XLogP | 4.09 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|