C27H43NO3 — CID 139892829
3-carboxynaphthalen-1-olate;tetrabutylazanium (PubChem CID 139892829) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is 3-carboxynaphthalen-1-olate;tetrabutylazanium.
| Compound Name | 3-carboxynaphthalen-1-olate;tetrabutylazanium |
|---|---|
| PubChem CID | 139892829 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | 3-carboxynaphthalen-1-olate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C(O)c1cc([O-])c2ccccc2c1 |
| InChI | InChI=1S/C16H36N.C11H8O3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;12-10-6-8(11(13)14)5-7-3-1-2-4-9(7)10/h5-16H2,1-4H3;1-6,12H,(H,13,14)/q+1;/p-1 |
| InChIKey | MHRXHYBFCORDSN-UHFFFAOYSA-M |
| XLogP | 6.62 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|