C30H47N3O4 — CID 139704007
2-carboxy-4-(phenylcarbamoylamino)phenolate;tetrabutylazanium (PubChem CID 139704007) has the molecular formula C30H47N3O4 and a molecular weight of 513.72 g/mol. Its IUPAC name is 2-carboxy-4-(phenylcarbamoylamino)phenolate;tetrabutylazanium.
| Compound Name | 2-carboxy-4-(phenylcarbamoylamino)phenolate;tetrabutylazanium |
|---|---|
| PubChem CID | 139704007 |
| Molecular Formula | C30H47N3O4 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.36 |
| IUPAC Name | 2-carboxy-4-(phenylcarbamoylamino)phenolate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C(Nc1ccccc1)Nc1ccc([O-])c(C(=O)O)c1 |
| InChI | InChI=1S/C16H36N.C14H12N2O4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;17-12-7-6-10(8-11(12)13(18)19)16-14(20)15-9-4-2-1-3-5-9/h5-16H2,1-4H3;1-8,17H,(H,18,19)(H2,15,16,20)/q+1;/p-1 |
| InChIKey | CVSOXMVZLUMGHN-UHFFFAOYSA-M |
| XLogP | 7.11 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|