C43H71N8O7P — CID 139204737
1-[2-[bis[2-(phenylcarbamoylamino)ethyl]amino]ethyl]-3-phenylurea;dihydrogen phosphate;tetrabutylazanium (PubChem CID 139204737) has the molecular formula C43H71N8O7P and a molecular weight of 843.06 g/mol. Its IUPAC name is 1-[2-[bis[2-(phenylcarbamoylamino)ethyl]amino]ethyl]-3-phenylurea;dihydrogen phosphate;tetrabutylazanium.
| Compound Name | 1-[2-[bis[2-(phenylcarbamoylamino)ethyl]amino]ethyl]-3-phenylurea;dihydrogen phosphate;tetrabutylazanium |
|---|---|
| PubChem CID | 139204737 |
| Molecular Formula | C43H71N8O7P |
| Molecular Weight | 843.06 g/mol |
| Exact Mass | 842.52 |
| IUPAC Name | 1-[2-[bis[2-(phenylcarbamoylamino)ethyl]amino]ethyl]-3-phenylurea;dihydrogen phosphate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C(NCCN(CCNC(=O)Nc1ccccc1)CCNC(=O)Nc1ccccc1)Nc1ccccc1.O=P([O-])(O)O |
| InChI | InChI=1S/C27H33N7O3.C16H36N.H3O4P/c35-25(31-22-10-4-1-5-11-22)28-16-19-34(20-17-29-26(36)32-23-12-6-2-7-13-23)21-18-30-27(37)33-24-14-8-3-9-15-24;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h1-15H,16-21H2,(H2,28,31,35)(H2,29,32,36)(H2,30,33,37);5-16H2,1-4H3;(H3,1,2,3,4)/q;+1;/p-1 |
| InChIKey | LUTRNQFZDQKRME-UHFFFAOYSA-M |
| XLogP | 7.20 |
| TPSA | 207.22 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.06 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|