C33H69N7O3 — CID 10555741
1-[2-[bis[2-(octylcarbamoylamino)ethyl]amino]ethyl]-3-octylurea (PubChem CID 10555741) has the molecular formula C33H69N7O3 and a molecular weight of 611.96 g/mol. Its IUPAC name is 1-[2-[bis[2-(octylcarbamoylamino)ethyl]amino]ethyl]-3-octylurea.
| Compound Name | 1-[2-[bis[2-(octylcarbamoylamino)ethyl]amino]ethyl]-3-octylurea |
|---|---|
| PubChem CID | 10555741 |
| Molecular Formula | C33H69N7O3 |
| Molecular Weight | 611.96 g/mol |
| Exact Mass | 611.55 |
| IUPAC Name | 1-[2-[bis[2-(octylcarbamoylamino)ethyl]amino]ethyl]-3-octylurea |
| SMILES | CCCCCCCCNC(=O)NCCN(CCNC(=O)NCCCCCCCC)CCNC(=O)NCCCCCCCC |
| InChI | InChI=1S/C33H69N7O3/c1-4-7-10-13-16-19-22-34-31(41)37-25-28-40(29-26-38-32(42)35-23-20-17-14-11-8-5-2)30-27-39-33(43)36-24-21-18-15-12-9-6-3/h4-30H2,1-3H3,(H2,34,37,41)(H2,35,38,42)(H2,36,39,43) |
| InChIKey | WSPKCOPZRBDNCC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.96 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|