About 2-chlorobenzoate;2-chlorobenzoic acid;tetrabutylazanium
2-chlorobenzoate;2-chlorobenzoic acid;tetrabutylazanium (PubChem CID 173406267) has the molecular formula C30H45Cl2NO4
and a molecular weight of 554.60 g/mol. Its IUPAC name is 2-chlorobenzoate;2-chlorobenzoic acid;tetrabutylazanium.
Molecular Properties
| Compound Name | 2-chlorobenzoate;2-chlorobenzoic acid;tetrabutylazanium |
| PubChem CID | 173406267 |
| Molecular Formula | C30H45Cl2NO4 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | 2-chlorobenzoate;2-chlorobenzoic acid;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C(O)c1ccccc1Cl.O=C([O-])c1ccccc1Cl |
| InChI | InChI=1S/C16H36N.2C7H5ClO2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2*8-6-4-2-1-3-5(6)7(9)10/h5-16H2,1-4H3;2*1-4H,(H,9,10)/q+1;;/p-1 |
| InChIKey | OONLOAXUBNEEBZ-UHFFFAOYSA-M |
| XLogP | 7.75 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobenzoate;2-chlorobenzoic acid;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobenzoate;2-chlorobenzoic acid;tetrabutylazanium?
The IUPAC name of 2-chlorobenzoate;2-chlorobenzoic acid;tetrabutylazanium (CID 173406267) is 2-chlorobenzoate;2-chlorobenzoic acid;tetrabutylazanium.
What is the SMILES notation for 2-chlorobenzoate;2-chlorobenzoic acid;tetrabutylazanium?
The canonical SMILES for 2-chlorobenzoate;2-chlorobenzoic acid;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.O=C(O)c1ccccc1Cl.O=C([O-])c1ccccc1Cl.
What is the InChIKey of 2-chlorobenzoate;2-chlorobenzoic acid;tetrabutylazanium?
The InChIKey is OONLOAXUBNEEBZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.2C7H5ClO2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2*8-6-4-2-1-3-5(6)7(9)10/h5-16H2,1-4H3;2*1-4H,(H,9,10)/q+1;;/p-1.
What are the key properties of 2-chlorobenzoate;2-chlorobenzoic acid;tetrabutylazanium?
2-chlorobenzoate;2-chlorobenzoic acid;tetrabutylazanium has a molecular weight of 554.60 g/mol, XLogP of 7.75, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobenzoate;2-chlorobenzoic acid;tetrabutylazanium is sourced from PubChem (CID 173406267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).