C18H10N2O5-2 — CID 135577537
3-carboxy-5-[(2-oxidonaphthalen-1-yl)diazenyl]benzoate (PubChem CID 135577537) has the molecular formula C18H10N2O5-2 and a molecular weight of 334.29 g/mol. Its IUPAC name is 3-carboxy-5-[(2-oxidonaphthalen-1-yl)diazenyl]benzoate.
| Compound Name | 3-carboxy-5-[(2-oxidonaphthalen-1-yl)diazenyl]benzoate |
|---|---|
| PubChem CID | 135577537 |
| Molecular Formula | C18H10N2O5-2 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 3-carboxy-5-[(2-oxidonaphthalen-1-yl)diazenyl]benzoate |
| SMILES | O=C([O-])c1cc(/N=N/c2c([O-])ccc3ccccc23)cc(C(=O)O)c1 |
| InChI | InChI=1S/C18H12N2O5/c21-15-6-5-10-3-1-2-4-14(10)16(15)20-19-13-8-11(17(22)23)7-12(9-13)18(24)25/h1-9,21H,(H,22,23)(H,24,25)/p-2/b20-19+ |
| InChIKey | CXQUYNPLPYNRQI-FMQUCBEESA-L |
| XLogP | 2.39 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|