C32H16Br6N4O2Pd — CID 139088105
palladium(2+);bis(1-[(2,4,6-tribromophenyl)diazenyl]naphthalen-2-olate) (PubChem CID 139088105) has the molecular formula C32H16Br6N4O2Pd and a molecular weight of 1074.35 g/mol. Its IUPAC name is palladium(2+);bis(1-[(2,4,6-tribromophenyl)diazenyl]naphthalen-2-olate).
| Compound Name | palladium(2+);bis(1-[(2,4,6-tribromophenyl)diazenyl]naphthalen-2-olate) |
|---|---|
| PubChem CID | 139088105 |
| Molecular Formula | C32H16Br6N4O2Pd |
| Molecular Weight | 1074.35 g/mol |
| Exact Mass | 1067.54 |
| IUPAC Name | palladium(2+);bis(1-[(2,4,6-tribromophenyl)diazenyl]naphthalen-2-olate) |
| SMILES | [O-]c1ccc2ccccc2c1/N=N/c1c(Br)cc(Br)cc1Br.[O-]c1ccc2ccccc2c1/N=N/c1c(Br)cc(Br)cc1Br.[Pd+2] |
| InChI | InChI=1S/2C16H9Br3N2O.Pd/c2*17-10-7-12(18)16(13(19)8-10)21-20-15-11-4-2-1-3-9(11)5-6-14(15)22;/h2*1-8,22H;/q;;+2/p-2/b2*21-20+; |
| InChIKey | MYFRJQLDEGDKMK-SQMNQOOUSA-L |
| XLogP | 13.23 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1074.35 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|