About copper;1-nitrosonaphthalen-2-ol;1-nitrosonaphthalen-2-olate
copper;1-nitrosonaphthalen-2-ol;1-nitrosonaphthalen-2-olate (PubChem CID 74219017) has the molecular formula C20H13CuN2O4+
and a molecular weight of 408.88 g/mol. Its IUPAC name is copper;1-nitrosonaphthalen-2-ol;1-nitrosonaphthalen-2-olate.
Molecular Properties
| Compound Name | copper;1-nitrosonaphthalen-2-ol;1-nitrosonaphthalen-2-olate |
| PubChem CID | 74219017 |
| Molecular Formula | C20H13CuN2O4+ |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | copper;1-nitrosonaphthalen-2-ol;1-nitrosonaphthalen-2-olate |
| SMILES | O=Nc1c(O)ccc2ccccc12.O=Nc1c([O-])ccc2ccccc12.[Cu+2] |
| InChI | InChI=1S/2C10H7NO2.Cu/c2*12-9-6-5-7-3-1-2-4-8(7)10(9)11-13;/h2*1-6,12H;/q;;+2/p-1 |
| InChIKey | NHHCPZIILHPWPF-UHFFFAOYSA-M |
| XLogP | 5.25 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze copper;1-nitrosonaphthalen-2-ol;1-nitrosonaphthalen-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;1-nitrosonaphthalen-2-ol;1-nitrosonaphthalen-2-olate?
The IUPAC name of copper;1-nitrosonaphthalen-2-ol;1-nitrosonaphthalen-2-olate (CID 74219017) is copper;1-nitrosonaphthalen-2-ol;1-nitrosonaphthalen-2-olate.
What is the SMILES notation for copper;1-nitrosonaphthalen-2-ol;1-nitrosonaphthalen-2-olate?
The canonical SMILES for copper;1-nitrosonaphthalen-2-ol;1-nitrosonaphthalen-2-olate is O=Nc1c(O)ccc2ccccc12.O=Nc1c([O-])ccc2ccccc12.[Cu+2].
What is the InChIKey of copper;1-nitrosonaphthalen-2-ol;1-nitrosonaphthalen-2-olate?
The InChIKey is NHHCPZIILHPWPF-UHFFFAOYSA-M. The full InChI is InChI=1S/2C10H7NO2.Cu/c2*12-9-6-5-7-3-1-2-4-8(7)10(9)11-13;/h2*1-6,12H;/q;;+2/p-1.
What are the key properties of copper;1-nitrosonaphthalen-2-ol;1-nitrosonaphthalen-2-olate?
copper;1-nitrosonaphthalen-2-ol;1-nitrosonaphthalen-2-olate has a molecular weight of 408.88 g/mol, XLogP of 5.25, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;1-nitrosonaphthalen-2-ol;1-nitrosonaphthalen-2-olate is sourced from PubChem (CID 74219017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).