C24H15CuN3O5 — CID 170853804
copper 3-carboxy-1-[[2-oxido-5-(phenylcarbamoyl)phenyl]diazenyl]naphthalen-2-olate (PubChem CID 170853804) has the molecular formula C24H15CuN3O5 and a molecular weight of 488.95 g/mol. Its IUPAC name is copper 3-carboxy-1-[[2-oxido-5-(phenylcarbamoyl)phenyl]diazenyl]naphthalen-2-olate.
| Compound Name | copper 3-carboxy-1-[[2-oxido-5-(phenylcarbamoyl)phenyl]diazenyl]naphthalen-2-olate |
|---|---|
| PubChem CID | 170853804 |
| Molecular Formula | C24H15CuN3O5 |
| Molecular Weight | 488.95 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | copper 3-carboxy-1-[[2-oxido-5-(phenylcarbamoyl)phenyl]diazenyl]naphthalen-2-olate |
| SMILES | O=C(Nc1ccccc1)c1ccc([O-])c(/N=N/c2c([O-])c(C(=O)O)cc3ccccc23)c1.[Cu+2] |
| InChI | InChI=1S/C24H17N3O5.Cu/c28-20-11-10-15(23(30)25-16-7-2-1-3-8-16)13-19(20)26-27-21-17-9-5-4-6-14(17)12-18(22(21)29)24(31)32;/h1-13,28-29H,(H,25,30)(H,31,32);/q;+2/p-2/b27-26+; |
| InChIKey | LCUIUWIMRZEKNS-JGUILPGDSA-L |
| XLogP | 4.35 |
| TPSA | 137.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.95 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|