C23H18ClN3O3 — CID 138503014
3-[anilino(hydroxy)methyl]-1-[(5-chloro-2-hydroxyphenyl)diazenyl]naphthalen-2-ol (PubChem CID 138503014) has the molecular formula C23H18ClN3O3 and a molecular weight of 419.87 g/mol. Its IUPAC name is 3-[anilino(hydroxy)methyl]-1-[(5-chloro-2-hydroxyphenyl)diazenyl]naphthalen-2-ol.
| Compound Name | 3-[anilino(hydroxy)methyl]-1-[(5-chloro-2-hydroxyphenyl)diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 138503014 |
| Molecular Formula | C23H18ClN3O3 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 3-[anilino(hydroxy)methyl]-1-[(5-chloro-2-hydroxyphenyl)diazenyl]naphthalen-2-ol |
| SMILES | Oc1ccc(Cl)cc1/N=N/c1c(O)c(C(O)Nc2ccccc2)cc2ccccc12 |
| InChI | InChI=1S/C23H18ClN3O3/c24-15-10-11-20(28)19(13-15)26-27-21-17-9-5-4-6-14(17)12-18(22(21)29)23(30)25-16-7-2-1-3-8-16/h1-13,23,25,28-30H/b27-26+ |
| InChIKey | QJMMMHRLNPGOSF-CYYJNZCTSA-N |
| XLogP | 6.42 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|