C23H19N3O3 — CID 135962626
3-(anilinooxymethyl)-1-[(2-hydroxyphenyl)diazenyl]naphthalen-2-ol (PubChem CID 135962626) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 3-(anilinooxymethyl)-1-[(2-hydroxyphenyl)diazenyl]naphthalen-2-ol.
| Compound Name | 3-(anilinooxymethyl)-1-[(2-hydroxyphenyl)diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 135962626 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-(anilinooxymethyl)-1-[(2-hydroxyphenyl)diazenyl]naphthalen-2-ol |
| SMILES | Oc1ccccc1/N=N/c1c(O)c(CONc2ccccc2)cc2ccccc12 |
| InChI | InChI=1S/C23H19N3O3/c27-21-13-7-6-12-20(21)24-25-22-19-11-5-4-8-16(19)14-17(23(22)28)15-29-26-18-9-2-1-3-10-18/h1-14,26-28H,15H2/b25-24+ |
| InChIKey | QHXVLVIVGRBPAO-OCOZRVBESA-N |
| XLogP | 6.21 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|