C20H18BrNO4 — CID 2235743
4-bromo-N-(2,4-dimethoxyphenyl)-3-methoxynaphthalene-2-carboxamide (PubChem CID 2235743) has the molecular formula C20H18BrNO4 and a molecular weight of 416.27 g/mol. Its IUPAC name is 4-bromo-N-(2,4-dimethoxyphenyl)-3-methoxynaphthalene-2-carboxamide.
| Compound Name | 4-bromo-N-(2,4-dimethoxyphenyl)-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 2235743 |
| Molecular Formula | C20H18BrNO4 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 4-bromo-N-(2,4-dimethoxyphenyl)-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3ccccc3c(Br)c2OC)c(OC)c1 |
| InChI | InChI=1S/C20H18BrNO4/c1-24-13-8-9-16(17(11-13)25-2)22-20(23)15-10-12-6-4-5-7-14(12)18(21)19(15)26-3/h4-11H,1-3H3,(H,22,23) |
| InChIKey | HDQPLRQXLKPTEG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |