C25H19BrClNO3 — CID 50882559
4-bromo-N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-3-methoxynaphthalene-2-carboxamide (PubChem CID 50882559) has the molecular formula C25H19BrClNO3 and a molecular weight of 496.79 g/mol. Its IUPAC name is 4-bromo-N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | 4-bromo-N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 50882559 |
| Molecular Formula | C25H19BrClNO3 |
| Molecular Weight | 496.79 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | 4-bromo-N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1c(C(=O)Nc2ccc(Cl)cc2C(O)c2ccccc2)cc2ccccc2c1Br |
| InChI | InChI=1S/C25H19BrClNO3/c1-31-24-20(13-16-9-5-6-10-18(16)22(24)26)25(30)28-21-12-11-17(27)14-19(21)23(29)15-7-3-2-4-8-15/h2-14,23,29H,1H3,(H,28,30) |
| InChIKey | FUEKVNFTYCPBLT-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.79 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |