C24H18ClNO2 — CID 50882541
N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]naphthalene-1-carboxamide (PubChem CID 50882541) has the molecular formula C24H18ClNO2 and a molecular weight of 387.87 g/mol. Its IUPAC name is N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]naphthalene-1-carboxamide.
| Compound Name | N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 50882541 |
| Molecular Formula | C24H18ClNO2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]naphthalene-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(O)c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H18ClNO2/c25-18-13-14-22(21(15-18)23(27)17-8-2-1-3-9-17)26-24(28)20-12-6-10-16-7-4-5-11-19(16)20/h1-15,23,27H,(H,26,28) |
| InChIKey | GAOCBXSRLFVXSC-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |