C22H20ClNO2 — CID 50882522
N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-3,4-dimethylbenzamide (PubChem CID 50882522) has the molecular formula C22H20ClNO2 and a molecular weight of 365.86 g/mol. Its IUPAC name is N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-3,4-dimethylbenzamide.
| Compound Name | N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 50882522 |
| Molecular Formula | C22H20ClNO2 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(Cl)cc2C(O)c2ccccc2)cc1C |
| InChI | InChI=1S/C22H20ClNO2/c1-14-8-9-17(12-15(14)2)22(26)24-20-11-10-18(23)13-19(20)21(25)16-6-4-3-5-7-16/h3-13,21,25H,1-2H3,(H,24,26) |
| InChIKey | VNXAWVCPNIOEPF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |