C21H17Cl2NO2 — CID 50882569
3-chloro-N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-4-methylbenzamide (PubChem CID 50882569) has the molecular formula C21H17Cl2NO2 and a molecular weight of 386.28 g/mol. Its IUPAC name is 3-chloro-N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-4-methylbenzamide.
| Compound Name | 3-chloro-N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 50882569 |
| Molecular Formula | C21H17Cl2NO2 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 3-chloro-N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(Cl)cc2C(O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H17Cl2NO2/c1-13-7-8-15(11-18(13)23)21(26)24-19-10-9-16(22)12-17(19)20(25)14-5-3-2-4-6-14/h2-12,20,25H,1H3,(H,24,26) |
| InChIKey | VZWMUVNUMNYVEL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |