C24H24ClNO3 — CID 95733544
3-butoxy-N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]benzamide (PubChem CID 95733544) has the molecular formula C24H24ClNO3 and a molecular weight of 409.91 g/mol. Its IUPAC name is 3-butoxy-N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]benzamide.
| Compound Name | 3-butoxy-N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 95733544 |
| Molecular Formula | C24H24ClNO3 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 3-butoxy-N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2ccc(Cl)cc2[C@H](O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H24ClNO3/c1-2-3-14-29-20-11-7-10-18(15-20)24(28)26-22-13-12-19(25)16-21(22)23(27)17-8-5-4-6-9-17/h4-13,15-16,23,27H,2-3,14H2,1H3,(H,26,28)/t23-/m1/s1 |
| InChIKey | KQTAHSDDDYRHOB-HSZRJFAPSA-N |
| XLogP | 5.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|