C26H28ClNO5 — CID 95733607
N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]-3,4,5-triethoxybenzamide (PubChem CID 95733607) has the molecular formula C26H28ClNO5 and a molecular weight of 469.97 g/mol. Its IUPAC name is N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 95733607 |
| Molecular Formula | C26H28ClNO5 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(Cl)cc2[C@@H](O)c2ccccc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C26H28ClNO5/c1-4-31-22-14-18(15-23(32-5-2)25(22)33-6-3)26(30)28-21-13-12-19(27)16-20(21)24(29)17-10-8-7-9-11-17/h7-16,24,29H,4-6H2,1-3H3,(H,28,30)/t24-/m0/s1 |
| InChIKey | XRPFBKKRSBLBBS-DEOSSOPVSA-N |
| XLogP | 5.87 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |