C24H17Cl2NO2 — CID 95733474
5-chloro-N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]naphthalene-1-carboxamide (PubChem CID 95733474) has the molecular formula C24H17Cl2NO2 and a molecular weight of 422.31 g/mol. Its IUPAC name is 5-chloro-N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]naphthalene-1-carboxamide.
| Compound Name | 5-chloro-N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 95733474 |
| Molecular Formula | C24H17Cl2NO2 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 5-chloro-N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]naphthalene-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1[C@@H](O)c1ccccc1)c1cccc2c(Cl)cccc12 |
| InChI | InChI=1S/C24H17Cl2NO2/c25-16-12-13-22(20(14-16)23(28)15-6-2-1-3-7-15)27-24(29)19-10-4-9-18-17(19)8-5-11-21(18)26/h1-14,23,28H,(H,27,29)/t23-/m0/s1 |
| InChIKey | QZSMQRNPWCNBCU-QHCPKHFHSA-N |
| XLogP | 6.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |