C18H11BrCl3NO2 — CID 17111249
4-bromo-3-methoxy-N-(2,4,5-trichlorophenyl)naphthalene-2-carboxamide (PubChem CID 17111249) has the molecular formula C18H11BrCl3NO2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-bromo-3-methoxy-N-(2,4,5-trichlorophenyl)naphthalene-2-carboxamide.
| Compound Name | 4-bromo-3-methoxy-N-(2,4,5-trichlorophenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 17111249 |
| Molecular Formula | C18H11BrCl3NO2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 456.90 |
| IUPAC Name | 4-bromo-3-methoxy-N-(2,4,5-trichlorophenyl)naphthalene-2-carboxamide |
| SMILES | COc1c(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc2ccccc2c1Br |
| InChI | InChI=1S/C18H11BrCl3NO2/c1-25-17-11(6-9-4-2-3-5-10(9)16(17)19)18(24)23-15-8-13(21)12(20)7-14(15)22/h2-8H,1H3,(H,23,24) |
| InChIKey | HZTHYAVIJIMRMC-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|