C19H15BrINO2 — CID 17117485
4-bromo-N-(4-iodo-2-methylphenyl)-3-methoxynaphthalene-2-carboxamide (PubChem CID 17117485) has the molecular formula C19H15BrINO2 and a molecular weight of 496.14 g/mol. Its IUPAC name is 4-bromo-N-(4-iodo-2-methylphenyl)-3-methoxynaphthalene-2-carboxamide.
| Compound Name | 4-bromo-N-(4-iodo-2-methylphenyl)-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 17117485 |
| Molecular Formula | C19H15BrINO2 |
| Molecular Weight | 496.14 g/mol |
| Exact Mass | 494.93 |
| IUPAC Name | 4-bromo-N-(4-iodo-2-methylphenyl)-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1c(C(=O)Nc2ccc(I)cc2C)cc2ccccc2c1Br |
| InChI | InChI=1S/C19H15BrINO2/c1-11-9-13(21)7-8-16(11)22-19(23)15-10-12-5-3-4-6-14(12)17(20)18(15)24-2/h3-10H,1-2H3,(H,22,23) |
| InChIKey | RZLPPTTUSPINQC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.14 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|