C15H13N3O10 — CID 168540750
methyl 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,5-dinitrobenzoate (PubChem CID 168540750) has the molecular formula C15H13N3O10 and a molecular weight of 395.28 g/mol. Its IUPAC name is methyl 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,5-dinitrobenzoate.
| Compound Name | methyl 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 168540750 |
| Molecular Formula | C15H13N3O10 |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | methyl 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,5-dinitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(NC=C2C(=O)OC(C)(C)OC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H13N3O10/c1-15(2)27-13(20)8(14(21)28-15)6-16-11-9(17(22)23)4-7(12(19)26-3)5-10(11)18(24)25/h4-6,16H,1-3H3 |
| InChIKey | RUOVGEROUJIJQJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 177.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|