C15H16N2O8 — CID 10948148
5-[(2,5-dimethoxy-3-nitroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 10948148) has the molecular formula C15H16N2O8 and a molecular weight of 352.30 g/mol. Its IUPAC name is 5-[(2,5-dimethoxy-3-nitroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2,5-dimethoxy-3-nitroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 10948148 |
| Molecular Formula | C15H16N2O8 |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 5-[(2,5-dimethoxy-3-nitroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1cc(NC=C2C(=O)OC(C)(C)OC2=O)c(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H16N2O8/c1-15(2)24-13(18)9(14(19)25-15)7-16-10-5-8(22-3)6-11(17(20)21)12(10)23-4/h5-7,16H,1-4H3 |
| InChIKey | HFGILCZDAVPITD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|