C14H13N3O7 — CID 168539902
3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-nitrobenzamide (PubChem CID 168539902) has the molecular formula C14H13N3O7 and a molecular weight of 335.27 g/mol. Its IUPAC name is 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-nitrobenzamide.
| Compound Name | 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 168539902 |
| Molecular Formula | C14H13N3O7 |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-nitrobenzamide |
| SMILES | CC1(C)OC(=O)C(=CNc2cc(C(N)=O)ccc2[N+](=O)[O-])C(=O)O1 |
| InChI | InChI=1S/C14H13N3O7/c1-14(2)23-12(19)8(13(20)24-14)6-16-9-5-7(11(15)18)3-4-10(9)17(21)22/h3-6,16H,1-2H3,(H2,15,18) |
| InChIKey | CRSLWRCCROBANS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|