C13H12N2O9S — CID 168540910
4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-nitrobenzenesulfonic acid (PubChem CID 168540910) has the molecular formula C13H12N2O9S and a molecular weight of 372.31 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-nitrobenzenesulfonic acid.
| Compound Name | 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 168540910 |
| Molecular Formula | C13H12N2O9S |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-nitrobenzenesulfonic acid |
| SMILES | CC1(C)OC(=O)C(=CNc2ccc(S(=O)(=O)O)c([N+](=O)[O-])c2)C(=O)O1 |
| InChI | InChI=1S/C13H12N2O9S/c1-13(2)23-11(16)8(12(17)24-13)6-14-7-3-4-10(25(20,21)22)9(5-7)15(18)19/h3-6,14H,1-2H3,(H,20,21,22) |
| InChIKey | ICORXBXUHRYTCU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|