C9H7N3O6S — CID 168524152
4-[(2-cyanoacetyl)amino]-2-nitrobenzenesulfonic acid (PubChem CID 168524152) has the molecular formula C9H7N3O6S and a molecular weight of 285.24 g/mol. Its IUPAC name is 4-[(2-cyanoacetyl)amino]-2-nitrobenzenesulfonic acid.
| Compound Name | 4-[(2-cyanoacetyl)amino]-2-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 168524152 |
| Molecular Formula | C9H7N3O6S |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 4-[(2-cyanoacetyl)amino]-2-nitrobenzenesulfonic acid |
| SMILES | N#CCC(=O)Nc1ccc(S(=O)(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H7N3O6S/c10-4-3-9(13)11-6-1-2-8(19(16,17)18)7(5-6)12(14)15/h1-2,5H,3H2,(H,11,13)(H,16,17,18) |
| InChIKey | ITPAQOLRQHHONN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 150.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|