C12H12N2O9S — CID 168566831
4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-nitrobenzenesulfonic acid (PubChem CID 168566831) has the molecular formula C12H12N2O9S and a molecular weight of 360.30 g/mol. Its IUPAC name is 4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-nitrobenzenesulfonic acid.
| Compound Name | 4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 168566831 |
| Molecular Formula | C12H12N2O9S |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 4-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-nitrobenzenesulfonic acid |
| SMILES | COC(=O)/C=C(/Nc1ccc(S(=O)(=O)O)c([N+](=O)[O-])c1)C(=O)OC |
| InChI | InChI=1S/C12H12N2O9S/c1-22-11(15)6-8(12(16)23-2)13-7-3-4-10(24(19,20)21)9(5-7)14(17)18/h3-6,13H,1-2H3,(H,19,20,21)/b8-6+ |
| InChIKey | FBPQZAVHZYHNKC-SOFGYWHQSA-N |
| XLogP | 0.48 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|