C20H18ClNO10S2 — CID 168568121
2-[2-(4-chloro-2-sulfophenyl)ethenyl]-5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzenesulfonic acid (PubChem CID 168568121) has the molecular formula C20H18ClNO10S2 and a molecular weight of 531.95 g/mol. Its IUPAC name is 2-[2-(4-chloro-2-sulfophenyl)ethenyl]-5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzenesulfonic acid.
| Compound Name | 2-[2-(4-chloro-2-sulfophenyl)ethenyl]-5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 168568121 |
| Molecular Formula | C20H18ClNO10S2 |
| Molecular Weight | 531.95 g/mol |
| Exact Mass | 531.01 |
| IUPAC Name | 2-[2-(4-chloro-2-sulfophenyl)ethenyl]-5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzenesulfonic acid |
| SMILES | COC(=O)/C=C(/Nc1ccc(C=Cc2ccc(Cl)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1)C(=O)OC |
| InChI | InChI=1S/C20H18ClNO10S2/c1-31-19(23)11-16(20(24)32-2)22-15-8-6-13(18(10-15)34(28,29)30)4-3-12-5-7-14(21)9-17(12)33(25,26)27/h3-11,22H,1-2H3,(H,25,26,27)(H,28,29,30)/b4-3?,16-11+ |
| InChIKey | VSJOJTJIUATKJG-KCRHZTLNSA-N |
| XLogP | 2.65 |
| TPSA | 173.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.95 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|