C18H15Cl2NO8S — CID 168568213
5-(2,4-dichlorophenoxy)-2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzenesulfonic acid (PubChem CID 168568213) has the molecular formula C18H15Cl2NO8S and a molecular weight of 476.29 g/mol. Its IUPAC name is 5-(2,4-dichlorophenoxy)-2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzenesulfonic acid.
| Compound Name | 5-(2,4-dichlorophenoxy)-2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 168568213 |
| Molecular Formula | C18H15Cl2NO8S |
| Molecular Weight | 476.29 g/mol |
| Exact Mass | 474.99 |
| IUPAC Name | 5-(2,4-dichlorophenoxy)-2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzenesulfonic acid |
| SMILES | COC(=O)/C=C(/Nc1ccc(Oc2ccc(Cl)cc2Cl)cc1S(=O)(=O)O)C(=O)OC |
| InChI | InChI=1S/C18H15Cl2NO8S/c1-27-17(22)9-14(18(23)28-2)21-13-5-4-11(8-16(13)30(24,25)26)29-15-6-3-10(19)7-12(15)20/h3-9,21H,1-2H3,(H,24,25,26)/b14-9+ |
| InChIKey | OPQGYRMYNBJUNG-NTEUORMPSA-N |
| XLogP | 3.67 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|