C14H14ClNO6 — CID 168566063
dimethyl (E)-2-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)amino]but-2-enedioate (PubChem CID 168566063) has the molecular formula C14H14ClNO6 and a molecular weight of 327.72 g/mol. Its IUPAC name is dimethyl (E)-2-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 168566063 |
| Molecular Formula | C14H14ClNO6 |
| Molecular Weight | 327.72 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | dimethyl (E)-2-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc2c(cc1Cl)OCCO2)C(=O)OC |
| InChI | InChI=1S/C14H14ClNO6/c1-19-13(17)7-10(14(18)20-2)16-9-6-12-11(5-8(9)15)21-3-4-22-12/h5-7,16H,3-4H2,1-2H3/b10-7+ |
| InChIKey | FGOGHXLNNGMQJB-JXMROGBWSA-N |
| XLogP | 1.75 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.72 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|