C17H21FN2O6 — CID 168569555
dimethyl (E)-2-[4-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]anilino]but-2-enedioate (PubChem CID 168569555) has the molecular formula C17H21FN2O6 and a molecular weight of 368.36 g/mol. Its IUPAC name is dimethyl (E)-2-[4-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569555 |
| Molecular Formula | C17H21FN2O6 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | dimethyl (E)-2-[4-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(F)c(NC(=O)OC(C)(C)C)c1)C(=O)OC |
| InChI | InChI=1S/C17H21FN2O6/c1-17(2,3)26-16(23)20-12-8-10(6-7-11(12)18)19-13(15(22)25-5)9-14(21)24-4/h6-9,19H,1-5H3,(H,20,23)/b13-9+ |
| InChIKey | NAIIGMNPBNIUAC-UKTHLTGXSA-N |
| XLogP | 2.81 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|