C17H14N2O7S2 — CID 168523064
5-[(2-cyanoacetyl)amino]-2-[2-(4-sulfophenyl)ethenyl]benzenesulfonic acid (PubChem CID 168523064) has the molecular formula C17H14N2O7S2 and a molecular weight of 422.44 g/mol. Its IUPAC name is 5-[(2-cyanoacetyl)amino]-2-[2-(4-sulfophenyl)ethenyl]benzenesulfonic acid.
| Compound Name | 5-[(2-cyanoacetyl)amino]-2-[2-(4-sulfophenyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 168523064 |
| Molecular Formula | C17H14N2O7S2 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 5-[(2-cyanoacetyl)amino]-2-[2-(4-sulfophenyl)ethenyl]benzenesulfonic acid |
| SMILES | N#CCC(=O)Nc1ccc(C=Cc2ccc(S(=O)(=O)O)cc2)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C17H14N2O7S2/c18-10-9-17(20)19-14-6-5-13(16(11-14)28(24,25)26)4-1-12-2-7-15(8-3-12)27(21,22)23/h1-8,11H,9H2,(H,19,20)(H,21,22,23)(H,24,25,26) |
| InChIKey | NIEXCTFQDAGYSL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 161.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|