C14H11N3O10 — CID 168540505
4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,5-dinitrobenzoic acid (PubChem CID 168540505) has the molecular formula C14H11N3O10 and a molecular weight of 381.25 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,5-dinitrobenzoic acid.
| Compound Name | 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,5-dinitrobenzoic acid |
|---|---|
| PubChem CID | 168540505 |
| Molecular Formula | C14H11N3O10 |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,5-dinitrobenzoic acid |
| SMILES | CC1(C)OC(=O)C(=CNc2c([N+](=O)[O-])cc(C(=O)O)cc2[N+](=O)[O-])C(=O)O1 |
| InChI | InChI=1S/C14H11N3O10/c1-14(2)26-12(20)7(13(21)27-14)5-15-10-8(16(22)23)3-6(11(18)19)4-9(10)17(24)25/h3-5,15H,1-2H3,(H,18,19) |
| InChIKey | VYMAOZABQNTZIR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 188.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|