C15H14BrNO6 — CID 168537836
3-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-methylbenzoic acid (PubChem CID 168537836) has the molecular formula C15H14BrNO6 and a molecular weight of 384.18 g/mol. Its IUPAC name is 3-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-methylbenzoic acid.
| Compound Name | 3-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 168537836 |
| Molecular Formula | C15H14BrNO6 |
| Molecular Weight | 384.18 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 3-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(Br)c1NC=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C15H14BrNO6/c1-7-4-8(12(18)19)5-10(16)11(7)17-6-9-13(20)22-15(2,3)23-14(9)21/h4-6,17H,1-3H3,(H,18,19) |
| InChIKey | FCLOBHWUUJMEBF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|